C31H26N2O7S — CID 4863754
ethyl 4-(3,4-dimethoxyphenyl)-2-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 4863754) has the molecular formula C31H26N2O7S and a molecular weight of 570.62 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethoxyphenyl)-2-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethoxyphenyl)-2-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4863754 |
| Molecular Formula | C31H26N2O7S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | ethyl 4-(3,4-dimethoxyphenyl)-2-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)sc(C)c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H26N2O7S/c1-5-40-31(37)26-25(18-13-14-23(38-3)24(16-18)39-4)17(2)41-28(26)32-27(34)19-9-8-10-20(15-19)33-29(35)21-11-6-7-12-22(21)30(33)36/h6-16H,5H2,1-4H3,(H,32,34) |
| InChIKey | KOUWMFSCLLHKEX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|