C24H25ClN2O4S — CID 110502892
ethyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 110502892) has the molecular formula C24H25ClN2O4S and a molecular weight of 472.99 g/mol. Its IUPAC name is ethyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 110502892 |
| Molecular Formula | C24H25ClN2O4S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | ethyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCCOc1ccc(C(=O)Nc2sc(C)c(-c3ccc(Cl)cc3)c2C(=O)OCC)cc1N |
| InChI | InChI=1S/C24H25ClN2O4S/c1-4-12-31-19-11-8-16(13-18(19)26)22(28)27-23-21(24(29)30-5-2)20(14(3)32-23)15-6-9-17(25)10-7-15/h6-11,13H,4-5,12,26H2,1-3H3,(H,27,28) |
| InChIKey | IDEQWJLEMILWKZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|