C25H26ClNO3S — CID 3610552
propyl 2-[(2-chlorobenzoyl)amino]-5-methyl-4-(4-propylphenyl)thiophene-3-carboxylate (PubChem CID 3610552) has the molecular formula C25H26ClNO3S and a molecular weight of 456.01 g/mol. Its IUPAC name is propyl 2-[(2-chlorobenzoyl)amino]-5-methyl-4-(4-propylphenyl)thiophene-3-carboxylate.
| Compound Name | propyl 2-[(2-chlorobenzoyl)amino]-5-methyl-4-(4-propylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3610552 |
| Molecular Formula | C25H26ClNO3S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | propyl 2-[(2-chlorobenzoyl)amino]-5-methyl-4-(4-propylphenyl)thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2ccccc2Cl)sc(C)c1-c1ccc(CCC)cc1 |
| InChI | InChI=1S/C25H26ClNO3S/c1-4-8-17-11-13-18(14-12-17)21-16(3)31-24(22(21)25(29)30-15-5-2)27-23(28)19-9-6-7-10-20(19)26/h6-7,9-14H,4-5,8,15H2,1-3H3,(H,27,28) |
| InChIKey | WIIDYUXUPRDUCR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|