C28H24BrNO3S — CID 19226199
methyl 4-(4-bromophenyl)-5-methyl-2-[[2-(2-phenylethyl)benzoyl]amino]thiophene-3-carboxylate (PubChem CID 19226199) has the molecular formula C28H24BrNO3S and a molecular weight of 534.48 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-5-methyl-2-[[2-(2-phenylethyl)benzoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-5-methyl-2-[[2-(2-phenylethyl)benzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19226199 |
| Molecular Formula | C28H24BrNO3S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | methyl 4-(4-bromophenyl)-5-methyl-2-[[2-(2-phenylethyl)benzoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccccc2CCc2ccccc2)sc(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H24BrNO3S/c1-18-24(21-14-16-22(29)17-15-21)25(28(32)33-2)27(34-18)30-26(31)23-11-7-6-10-20(23)13-12-19-8-4-3-5-9-19/h3-11,14-17H,12-13H2,1-2H3,(H,30,31) |
| InChIKey | QLPHEBILLHEJKA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|