C20H14BrClN2O5S — CID 19226572
methyl 4-(4-bromophenyl)-2-[(2-chloro-4-nitrobenzoyl)amino]-5-methylthiophene-3-carboxylate (PubChem CID 19226572) has the molecular formula C20H14BrClN2O5S and a molecular weight of 509.77 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[(2-chloro-4-nitrobenzoyl)amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[(2-chloro-4-nitrobenzoyl)amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19226572 |
| Molecular Formula | C20H14BrClN2O5S |
| Molecular Weight | 509.77 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[(2-chloro-4-nitrobenzoyl)amino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)sc(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H14BrClN2O5S/c1-10-16(11-3-5-12(21)6-4-11)17(20(26)29-2)19(30-10)23-18(25)14-8-7-13(24(27)28)9-15(14)22/h3-9H,1-2H3,(H,23,25) |
| InChIKey | VWBBFHRDDKWQAH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|