C23H16BrNO5S — CID 19199830
methyl 4-(4-bromophenyl)-5-methyl-2-[(2-oxochromene-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19199830) has the molecular formula C23H16BrNO5S and a molecular weight of 498.35 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-5-methyl-2-[(2-oxochromene-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-5-methyl-2-[(2-oxochromene-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19199830 |
| Molecular Formula | C23H16BrNO5S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | methyl 4-(4-bromophenyl)-5-methyl-2-[(2-oxochromene-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc3ccccc3oc2=O)sc(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H16BrNO5S/c1-12-18(13-7-9-15(24)10-8-13)19(23(28)29-2)21(31-12)25-20(26)16-11-14-5-3-4-6-17(14)30-22(16)27/h3-11H,1-2H3,(H,25,26) |
| InChIKey | QUVPXEYTZCEAEF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|