C23H15BrFNO5S — CID 19227473
methyl 2-[(6-bromo-2-oxochromene-3-carbonyl)amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19227473) has the molecular formula C23H15BrFNO5S and a molecular weight of 516.34 g/mol. Its IUPAC name is methyl 2-[(6-bromo-2-oxochromene-3-carbonyl)amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(6-bromo-2-oxochromene-3-carbonyl)amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19227473 |
| Molecular Formula | C23H15BrFNO5S |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | methyl 2-[(6-bromo-2-oxochromene-3-carbonyl)amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc3cc(Br)ccc3oc2=O)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H15BrFNO5S/c1-11-18(12-3-6-15(25)7-4-12)19(23(29)30-2)21(32-11)26-20(27)16-10-13-9-14(24)5-8-17(13)31-22(16)28/h3-10H,1-2H3,(H,26,27) |
| InChIKey | HRLTZACCERBJPI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|