C23H15BrN2O4S — CID 4319423
6-bromo-N-[3-cyano-4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 4319423) has the molecular formula C23H15BrN2O4S and a molecular weight of 495.35 g/mol. Its IUPAC name is 6-bromo-N-[3-cyano-4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-[3-cyano-4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4319423 |
| Molecular Formula | C23H15BrN2O4S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | 6-bromo-N-[3-cyano-4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(-c2c(C)sc(NC(=O)c3cc4cc(Br)ccc4oc3=O)c2C#N)cc1 |
| InChI | InChI=1S/C23H15BrN2O4S/c1-12-20(13-3-6-16(29-2)7-4-13)18(11-25)22(31-12)26-21(27)17-10-14-9-15(24)5-8-19(14)30-23(17)28/h3-10H,1-2H3,(H,26,27) |
| InChIKey | LGQSOLVKBHERDI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|