C21H20BrNO4 — CID 2102409
6-bromo-N-(5-tert-butyl-2-methoxyphenyl)-2-oxochromene-3-carboxamide (PubChem CID 2102409) has the molecular formula C21H20BrNO4 and a molecular weight of 430.30 g/mol. Its IUPAC name is 6-bromo-N-(5-tert-butyl-2-methoxyphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-(5-tert-butyl-2-methoxyphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 2102409 |
| Molecular Formula | C21H20BrNO4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 6-bromo-N-(5-tert-butyl-2-methoxyphenyl)-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C21H20BrNO4/c1-21(2,3)13-5-7-18(26-4)16(11-13)23-19(24)15-10-12-9-14(22)6-8-17(12)27-20(15)25/h5-11H,1-4H3,(H,23,24) |
| InChIKey | UDCIAAQEKMTVHK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|