C17H12BrClN2O3 — CID 17374434
6-bromo-N-(5-chloro-2-methoxyphenyl)-2-iminochromene-3-carboxamide (PubChem CID 17374434) has the molecular formula C17H12BrClN2O3 and a molecular weight of 407.65 g/mol. Its IUPAC name is 6-bromo-N-(5-chloro-2-methoxyphenyl)-2-iminochromene-3-carboxamide.
| Compound Name | 6-bromo-N-(5-chloro-2-methoxyphenyl)-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 17374434 |
| Molecular Formula | C17H12BrClN2O3 |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 6-bromo-N-(5-chloro-2-methoxyphenyl)-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Br)cc2cc1C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H12BrClN2O3/c1-23-15-5-3-11(19)8-13(15)21-17(22)12-7-9-6-10(18)2-4-14(9)24-16(12)20/h2-8,20H,1H3,(H,21,22)/b20-16- |
| InChIKey | OODUPBDTYHCJJZ-SILNSSARSA-N |
| XLogP | 4.59 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |