C17H13ClN2O3 — CID 19573962
6-chloro-2-imino-N-(2-methoxyphenyl)chromene-3-carboxamide (PubChem CID 19573962) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.75 g/mol. Its IUPAC name is 6-chloro-2-imino-N-(2-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 6-chloro-2-imino-N-(2-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 19573962 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 6-chloro-2-imino-N-(2-methoxyphenyl)chromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Cl)cc2cc1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C17H13ClN2O3/c1-22-15-5-3-2-4-13(15)20-17(21)12-9-10-8-11(18)6-7-14(10)23-16(12)19/h2-9,19H,1H3,(H,20,21)/b19-16- |
| InChIKey | QXXBZXMZHCFACY-MNDPQUGUSA-N |
| XLogP | 3.83 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |