C16H12ClN3O4S — CID 19289000
6-chloro-2-imino-N-(4-sulfamoylphenyl)chromene-3-carboxamide (PubChem CID 19289000) has the molecular formula C16H12ClN3O4S and a molecular weight of 377.81 g/mol. Its IUPAC name is 6-chloro-2-imino-N-(4-sulfamoylphenyl)chromene-3-carboxamide.
| Compound Name | 6-chloro-2-imino-N-(4-sulfamoylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 19289000 |
| Molecular Formula | C16H12ClN3O4S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 6-chloro-2-imino-N-(4-sulfamoylphenyl)chromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Cl)cc2cc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H12ClN3O4S/c17-10-1-6-14-9(7-10)8-13(15(18)24-14)16(21)20-11-2-4-12(5-3-11)25(19,22)23/h1-8,18H,(H,20,21)(H2,19,22,23)/b18-15- |
| InChIKey | OUZBVQBTRUWWDZ-SDXDJHTJSA-N |
| XLogP | 2.47 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |