C16H10Cl2N2O5S — CID 1318003
6,8-dichloro-2-oxo-N-(4-sulfamoylphenyl)chromene-3-carboxamide (PubChem CID 1318003) has the molecular formula C16H10Cl2N2O5S and a molecular weight of 413.24 g/mol. Its IUPAC name is 6,8-dichloro-2-oxo-N-(4-sulfamoylphenyl)chromene-3-carboxamide.
| Compound Name | 6,8-dichloro-2-oxo-N-(4-sulfamoylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 1318003 |
| Molecular Formula | C16H10Cl2N2O5S |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 6,8-dichloro-2-oxo-N-(4-sulfamoylphenyl)chromene-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cc3cc(Cl)cc(Cl)c3oc2=O)cc1 |
| InChI | InChI=1S/C16H10Cl2N2O5S/c17-9-5-8-6-12(16(22)25-14(8)13(18)7-9)15(21)20-10-1-3-11(4-2-10)26(19,23)24/h1-7H,(H,20,21)(H2,19,23,24) |
| InChIKey | FOVSVIQRZVFKFA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|