C11H6Cl2O4 — CID 75527754
methyl 6,8-dichloro-2-oxochromene-3-carboxylate (PubChem CID 75527754) has the molecular formula C11H6Cl2O4 and a molecular weight of 273.07 g/mol. Its IUPAC name is methyl 6,8-dichloro-2-oxochromene-3-carboxylate.
| Compound Name | methyl 6,8-dichloro-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 75527754 |
| Molecular Formula | C11H6Cl2O4 |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | methyl 6,8-dichloro-2-oxochromene-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C11H6Cl2O4/c1-16-10(14)7-3-5-2-6(12)4-8(13)9(5)17-11(7)15/h2-4H,1H3 |
| InChIKey | BVNPKJUVBXTFSI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|