C14H13Cl2NO4 — CID 18524696
6,8-dichloro-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide (PubChem CID 18524696) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 6,8-dichloro-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dichloro-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 18524696 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 6,8-dichloro-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide |
| SMILES | COCCCNC(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C14H13Cl2NO4/c1-20-4-2-3-17-13(18)10-6-8-5-9(15)7-11(16)12(8)21-14(10)19/h5-7H,2-4H2,1H3,(H,17,18) |
| InChIKey | XGWOCMZNMSCOMQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|