C11H15ClN2O2 — CID 81225395
4-chloro-N-(3-methoxypropyl)-6-methylpyridine-3-carboxamide (PubChem CID 81225395) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-chloro-N-(3-methoxypropyl)-6-methylpyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(3-methoxypropyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81225395 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-chloro-N-(3-methoxypropyl)-6-methylpyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cnc(C)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-8-6-10(12)9(7-14-8)11(15)13-4-3-5-16-2/h6-7H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | NOKGQFPBNGGTKO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|