C11H16N2O2 — CID 123301076
N-(2-methoxyethyl)-4,6-dimethylpyridine-3-carboxamide (PubChem CID 123301076) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123301076 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(2-methoxyethyl)-4,6-dimethylpyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnc(C)cc1C |
| InChI | InChI=1S/C11H16N2O2/c1-8-6-9(2)13-7-10(8)11(14)12-4-5-15-3/h6-7H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | YAPDJSLOMWWACS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|