C14H18Br2N2O4 — CID 34673873
2,5-dibromo-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide (PubChem CID 34673873) has the molecular formula C14H18Br2N2O4 and a molecular weight of 438.12 g/mol. Its IUPAC name is 2,5-dibromo-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide.
| Compound Name | 2,5-dibromo-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 34673873 |
| Molecular Formula | C14H18Br2N2O4 |
| Molecular Weight | 438.12 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 2,5-dibromo-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide |
| SMILES | COCCNC(=O)c1cc(Br)c(C(=O)NCCOC)cc1Br |
| InChI | InChI=1S/C14H18Br2N2O4/c1-21-5-3-17-13(19)9-7-12(16)10(8-11(9)15)14(20)18-4-6-22-2/h7-8H,3-6H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | CPLICXBCUOMBSR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|