C16H22Br2N2O2 — CID 57338151
4,6-dibromo-1-N,3-N-dibutylbenzene-1,3-dicarboxamide (PubChem CID 57338151) has the molecular formula C16H22Br2N2O2 and a molecular weight of 434.17 g/mol. Its IUPAC name is 4,6-dibromo-1-N,3-N-dibutylbenzene-1,3-dicarboxamide.
| Compound Name | 4,6-dibromo-1-N,3-N-dibutylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 57338151 |
| Molecular Formula | C16H22Br2N2O2 |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 4,6-dibromo-1-N,3-N-dibutylbenzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)NCCCC)c(Br)cc1Br |
| InChI | InChI=1S/C16H22Br2N2O2/c1-3-5-7-19-15(21)11-9-12(14(18)10-13(11)17)16(22)20-8-6-4-2/h9-10H,3-8H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | GETADVUWUDHUDE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|