C22H12Cl2O5 — CID 4913017
(2-naphthalen-1-yl-2-oxoethyl) 6,8-dichloro-2-oxochromene-3-carboxylate (PubChem CID 4913017) has the molecular formula C22H12Cl2O5 and a molecular weight of 427.24 g/mol. Its IUPAC name is (2-naphthalen-1-yl-2-oxoethyl) 6,8-dichloro-2-oxochromene-3-carboxylate.
| Compound Name | (2-naphthalen-1-yl-2-oxoethyl) 6,8-dichloro-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 4913017 |
| Molecular Formula | C22H12Cl2O5 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (2-naphthalen-1-yl-2-oxoethyl) 6,8-dichloro-2-oxochromene-3-carboxylate |
| SMILES | O=C(OCC(=O)c1cccc2ccccc12)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C22H12Cl2O5/c23-14-8-13-9-17(22(27)29-20(13)18(24)10-14)21(26)28-11-19(25)16-7-3-5-12-4-1-2-6-15(12)16/h1-10H,11H2 |
| InChIKey | CROWSOCWLMOHLJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|