C21H18O3 — CID 7785268
[2-(2,4-dimethylphenyl)-2-oxoethyl] naphthalene-1-carboxylate (PubChem CID 7785268) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] naphthalene-1-carboxylate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 7785268 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] naphthalene-1-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H18O3/c1-14-10-11-17(15(2)12-14)20(22)13-24-21(23)19-9-5-7-16-6-3-4-8-18(16)19/h3-12H,13H2,1-2H3 |
| InChIKey | RHMQLGJTJKZZOA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |