C27H21NO4 — CID 126184955
(2-naphthalen-1-yl-2-oxoethyl) 4-[(4-methylbenzoyl)amino]benzoate (PubChem CID 126184955) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2-naphthalen-1-yl-2-oxoethyl) 4-[(4-methylbenzoyl)amino]benzoate.
| Compound Name | (2-naphthalen-1-yl-2-oxoethyl) 4-[(4-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 126184955 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (2-naphthalen-1-yl-2-oxoethyl) 4-[(4-methylbenzoyl)amino]benzoate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)OCC(=O)c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C27H21NO4/c1-18-9-11-20(12-10-18)26(30)28-22-15-13-21(14-16-22)27(31)32-17-25(29)24-8-4-6-19-5-2-3-7-23(19)24/h2-16H,17H2,1H3,(H,28,30) |
| InChIKey | MRMQNCAFUYOKAI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |