C22H19NO4 — CID 1218309
(2-naphthalen-1-yl-2-oxoethyl) 4-(propanoylamino)benzoate (PubChem CID 1218309) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2-naphthalen-1-yl-2-oxoethyl) 4-(propanoylamino)benzoate.
| Compound Name | (2-naphthalen-1-yl-2-oxoethyl) 4-(propanoylamino)benzoate |
|---|---|
| PubChem CID | 1218309 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2-naphthalen-1-yl-2-oxoethyl) 4-(propanoylamino)benzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)OCC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H19NO4/c1-2-21(25)23-17-12-10-16(11-13-17)22(26)27-14-20(24)19-9-5-7-15-6-3-4-8-18(15)19/h3-13H,2,14H2,1H3,(H,23,25) |
| InChIKey | GDDILYJIRFKYJZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |