C19H18INO4 — CID 46805683
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-iodobenzoate (PubChem CID 46805683) has the molecular formula C19H18INO4 and a molecular weight of 451.26 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 46805683 |
| Molecular Formula | C19H18INO4 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-iodobenzoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H18INO4/c1-2-3-18(23)21-16-10-6-13(7-11-16)17(22)12-25-19(24)14-4-8-15(20)9-5-14/h4-11H,2-3,12H2,1H3,(H,21,23) |
| InChIKey | XKCVNJVNXGIGTR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|