C18H18INO3 — CID 55357186
N-[4-[2-(3-iodophenoxy)acetyl]phenyl]butanamide (PubChem CID 55357186) has the molecular formula C18H18INO3 and a molecular weight of 423.25 g/mol. Its IUPAC name is N-[4-[2-(3-iodophenoxy)acetyl]phenyl]butanamide.
| Compound Name | N-[4-[2-(3-iodophenoxy)acetyl]phenyl]butanamide |
|---|---|
| PubChem CID | 55357186 |
| Molecular Formula | C18H18INO3 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-[4-[2-(3-iodophenoxy)acetyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COc2cccc(I)c2)cc1 |
| InChI | InChI=1S/C18H18INO3/c1-2-4-18(22)20-15-9-7-13(8-10-15)17(21)12-23-16-6-3-5-14(19)11-16/h3,5-11H,2,4,12H2,1H3,(H,20,22) |
| InChIKey | DVHNQJSBGIZXSA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|