C21H23NO4 — CID 7560345
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3,4-dimethylbenzoate (PubChem CID 7560345) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3,4-dimethylbenzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7560345 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3,4-dimethylbenzoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-4-5-20(24)22-18-10-8-16(9-11-18)19(23)13-26-21(25)17-7-6-14(2)15(3)12-17/h6-12H,4-5,13H2,1-3H3,(H,22,24) |
| InChIKey | QTABZBKYHQUDPA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |