C21H23NO5 — CID 7790011
[2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 7790011) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7790011 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)COC(=O)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-2-3-4-8-20(25)22-17-11-9-15(10-12-17)19(24)14-27-21(26)16-6-5-7-18(23)13-16/h5-7,9-13,23H,2-4,8,14H2,1H3,(H,22,25) |
| InChIKey | VUHJMTPAJRCBQJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|