C17H17NO3 — CID 725026
(2-anilino-2-oxoethyl) 3,4-dimethylbenzoate (PubChem CID 725026) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 3,4-dimethylbenzoate.
| Compound Name | (2-anilino-2-oxoethyl) 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 725026 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2-anilino-2-oxoethyl) 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ccccc2)cc1C |
| InChI | InChI=1S/C17H17NO3/c1-12-8-9-14(10-13(12)2)17(20)21-11-16(19)18-15-6-4-3-5-7-15/h3-10H,11H2,1-2H3,(H,18,19) |
| InChIKey | XDRACDQVSRJAET-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |