C17H17NO4 — CID 17423458
[2-(4-methylanilino)-2-oxoethyl] 3-hydroxy-4-methylbenzoate (PubChem CID 17423458) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 3-hydroxy-4-methylbenzoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 3-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 17423458 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 3-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(C)c(O)c2)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-11-3-7-14(8-4-11)18-16(20)10-22-17(21)13-6-5-12(2)15(19)9-13/h3-9,19H,10H2,1-2H3,(H,18,20) |
| InChIKey | CCHOYNXQHUVCTC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |