C24H21NO4 — CID 7229145
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-phenylbenzoate (PubChem CID 7229145) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-phenylbenzoate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229145 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-phenylbenzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-2-23(27)25-19-14-12-18(13-15-19)22(26)16-29-24(28)21-11-7-6-10-20(21)17-8-4-3-5-9-17/h3-15H,2,16H2,1H3,(H,25,27) |
| InChIKey | OFYOIWGHNQYQIZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |