C23H20O3 — CID 7229156
[2-(2,4-dimethylphenyl)-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229156) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229156 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-phenylbenzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H20O3/c1-16-12-13-19(17(2)14-16)22(24)15-26-23(25)21-11-7-6-10-20(21)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3 |
| InChIKey | YWPJXJAMSVDGJM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |