C25H14Cl2N2O4S — CID 155814065
2-[2-(6,8-dichloro-2-oxochromen-3-yl)-2-oxoethyl]sulfanyl-3-phenylquinazolin-4-one (PubChem CID 155814065) has the molecular formula C25H14Cl2N2O4S and a molecular weight of 509.37 g/mol. Its IUPAC name is 2-[2-(6,8-dichloro-2-oxochromen-3-yl)-2-oxoethyl]sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-(6,8-dichloro-2-oxochromen-3-yl)-2-oxoethyl]sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 155814065 |
| Molecular Formula | C25H14Cl2N2O4S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 2-[2-(6,8-dichloro-2-oxochromen-3-yl)-2-oxoethyl]sulfanyl-3-phenylquinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccccc1)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C25H14Cl2N2O4S/c26-15-10-14-11-18(24(32)33-22(14)19(27)12-15)21(30)13-34-25-28-20-9-5-4-8-17(20)23(31)29(25)16-6-2-1-3-7-16/h1-12H,13H2 |
| InChIKey | HAORWSDLBZFGBT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|