C15H9Cl2IO3 — CID 1337088
[2-(2,4-dichlorophenyl)-2-oxoethyl] 2-iodobenzoate (PubChem CID 1337088) has the molecular formula C15H9Cl2IO3 and a molecular weight of 435.04 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 1337088 |
| Molecular Formula | C15H9Cl2IO3 |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-iodobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1I)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2IO3/c16-9-5-6-10(12(17)7-9)14(19)8-21-15(20)11-3-1-2-4-13(11)18/h1-7H,8H2 |
| InChIKey | ASSHCRIJIJHPJG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|