C36H28Cl2N4O6 — CID 15467298
6-chloro-N-[2-[4-[2-[(6-chloro-2-iminochromene-3-carbonyl)amino]phenoxy]butoxy]phenyl]-2-iminochromene-3-carboxamide (PubChem CID 15467298) has the molecular formula C36H28Cl2N4O6 and a molecular weight of 683.55 g/mol. Its IUPAC name is 6-chloro-N-[2-[4-[2-[(6-chloro-2-iminochromene-3-carbonyl)amino]phenoxy]butoxy]phenyl]-2-iminochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[4-[2-[(6-chloro-2-iminochromene-3-carbonyl)amino]phenoxy]butoxy]phenyl]-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 15467298 |
| Molecular Formula | C36H28Cl2N4O6 |
| Molecular Weight | 683.55 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | 6-chloro-N-[2-[4-[2-[(6-chloro-2-iminochromene-3-carbonyl)amino]phenoxy]butoxy]phenyl]-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Cl)cc2cc1C(=O)Nc1ccccc1OCCCCOc1ccccc1NC(=O)c1cc2cc(Cl)ccc2o/c1=N\[H] |
| InChI | InChI=1S/C36H28Cl2N4O6/c37-23-11-13-29-21(17-23)19-25(33(39)47-29)35(43)41-27-7-1-3-9-31(27)45-15-5-6-16-46-32-10-4-2-8-28(32)42-36(44)26-20-22-18-24(38)12-14-30(22)48-34(26)40/h1-4,7-14,17-20,39-40H,5-6,15-16H2,(H,41,43)(H,42,44)/b39-33-,40-34- |
| InChIKey | NSHAIVJAJPCVCV-LYDIVBJWSA-N |
| XLogP | 8.19 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.55 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|