C18H13ClN2O3 — CID 19574019
N-(4-acetylphenyl)-6-chloro-2-iminochromene-3-carboxamide (PubChem CID 19574019) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is N-(4-acetylphenyl)-6-chloro-2-iminochromene-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-6-chloro-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 19574019 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-(4-acetylphenyl)-6-chloro-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Cl)cc2cc1C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C18H13ClN2O3/c1-10(22)11-2-5-14(6-3-11)21-18(23)15-9-12-8-13(19)4-7-16(12)24-17(15)20/h2-9,20H,1H3,(H,21,23)/b20-17- |
| InChIKey | DTBXEJQRAVHEER-JZJYNLBNSA-N |
| XLogP | 4.02 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |