C17H13BrN2O3 — CID 17373619
6-bromo-2-imino-N-(3-methoxyphenyl)chromene-3-carboxamide (PubChem CID 17373619) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 6-bromo-2-imino-N-(3-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 6-bromo-2-imino-N-(3-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 17373619 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 6-bromo-2-imino-N-(3-methoxyphenyl)chromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccc(Br)cc2cc1C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C17H13BrN2O3/c1-22-13-4-2-3-12(9-13)20-17(21)14-8-10-7-11(18)5-6-15(10)23-16(14)19/h2-9,19H,1H3,(H,20,21)/b19-16- |
| InChIKey | XIGUJWKDRQPPFR-MNDPQUGUSA-N |
| XLogP | 3.94 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |