C23H17BrN2O4S — CID 19573832
methyl 5-benzyl-2-[(6-bromo-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19573832) has the molecular formula C23H17BrN2O4S and a molecular weight of 497.37 g/mol. Its IUPAC name is methyl 5-benzyl-2-[(6-bromo-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[(6-bromo-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19573832 |
| Molecular Formula | C23H17BrN2O4S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | methyl 5-benzyl-2-[(6-bromo-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2ccc(Br)cc2cc1C(=O)Nc1sc(Cc2ccccc2)cc1C(=O)OC |
| InChI | InChI=1S/C23H17BrN2O4S/c1-29-23(28)18-12-16(9-13-5-3-2-4-6-13)31-22(18)26-21(27)17-11-14-10-15(24)7-8-19(14)30-20(17)25/h2-8,10-12,25H,9H2,1H3,(H,26,27)/b25-20- |
| InChIKey | HLMWBCAJAFKQJS-QQTULTPQSA-N |
| XLogP | 5.37 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |