C16H13Cl3N2O4S — CID 67077772
methyl 5-benzyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxylate (PubChem CID 67077772) has the molecular formula C16H13Cl3N2O4S and a molecular weight of 435.72 g/mol. Its IUPAC name is methyl 5-benzyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 67077772 |
| Molecular Formula | C16H13Cl3N2O4S |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | methyl 5-benzyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=O)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H13Cl3N2O4S/c1-25-13(22)11-8-10(7-9-5-3-2-4-6-9)26-12(11)20-15(24)21-14(23)16(17,18)19/h2-6,8H,7H2,1H3,(H2,20,21,23,24) |
| InChIKey | ZKVZTRCSEVULGO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|