C19H23N3O4S3 — CID 19687959
methyl 5-benzyl-2-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate (PubChem CID 19687959) has the molecular formula C19H23N3O4S3 and a molecular weight of 453.61 g/mol. Its IUPAC name is methyl 5-benzyl-2-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19687959 |
| Molecular Formula | C19H23N3O4S3 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | methyl 5-benzyl-2-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H23N3O4S3/c1-26-18(23)16-13-15(12-14-6-4-3-5-7-14)28-17(16)20-19(27)21-8-10-22(11-9-21)29(2,24)25/h3-7,13H,8-12H2,1-2H3,(H,20,27) |
| InChIKey | QDYRCRYLMHLJKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|