C27H29N3O2S2 — CID 19655411
methyl 5-benzyl-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioyl]amino]thiophene-3-carboxylate (PubChem CID 19655411) has the molecular formula C27H29N3O2S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is methyl 5-benzyl-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655411 |
| Molecular Formula | C27H29N3O2S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | methyl 5-benzyl-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N3O2S2/c1-32-26(31)24-20-23(19-22-11-6-3-7-12-22)34-25(24)28-27(33)30-17-15-29(16-18-30)14-8-13-21-9-4-2-5-10-21/h2-13,20H,14-19H2,1H3,(H,28,33)/b13-8+ |
| InChIKey | WOOYWHQCNDCCQH-MDWZMJQESA-N |
| XLogP | 5.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|