C23H22N2O2S2 — CID 19686790
methyl 5-benzyl-2-(3,4-dihydro-2H-quinoline-1-carbothioylamino)thiophene-3-carboxylate (PubChem CID 19686790) has the molecular formula C23H22N2O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is methyl 5-benzyl-2-(3,4-dihydro-2H-quinoline-1-carbothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-(3,4-dihydro-2H-quinoline-1-carbothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19686790 |
| Molecular Formula | C23H22N2O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 5-benzyl-2-(3,4-dihydro-2H-quinoline-1-carbothioylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H22N2O2S2/c1-27-22(26)19-15-18(14-16-8-3-2-4-9-16)29-21(19)24-23(28)25-13-7-11-17-10-5-6-12-20(17)25/h2-6,8-10,12,15H,7,11,13-14H2,1H3,(H,24,28) |
| InChIKey | OEJFHFZEFQQTKJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|