C17H11Br2NO4 — CID 1111870
6,8-dibromo-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide (PubChem CID 1111870) has the molecular formula C17H11Br2NO4 and a molecular weight of 453.09 g/mol. Its IUPAC name is 6,8-dibromo-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dibromo-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1111870 |
| Molecular Formula | C17H11Br2NO4 |
| Molecular Weight | 453.09 g/mol |
| Exact Mass | 450.91 |
| IUPAC Name | 6,8-dibromo-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc3cc(Br)cc(Br)c3oc2=O)c1 |
| InChI | InChI=1S/C17H11Br2NO4/c1-23-12-4-2-3-11(8-12)20-16(21)13-6-9-5-10(18)7-14(19)15(9)24-17(13)22/h2-8H,1H3,(H,20,21) |
| InChIKey | MJOWTDDQLBKTFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.09 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|