C23H13Br2N3O3 — CID 3753129
6,8-dibromo-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-2-oxochromene-3-carboxamide (PubChem CID 3753129) has the molecular formula C23H13Br2N3O3 and a molecular weight of 539.18 g/mol. Its IUPAC name is 6,8-dibromo-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dibromo-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3753129 |
| Molecular Formula | C23H13Br2N3O3 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 536.93 |
| IUPAC Name | 6,8-dibromo-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cn3ccccc3n2)c1)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C23H13Br2N3O3/c24-15-8-14-10-17(23(30)31-21(14)18(25)11-15)22(29)26-16-5-3-4-13(9-16)19-12-28-7-2-1-6-20(28)27-19/h1-12H,(H,26,29) |
| InChIKey | LCNZPCWUXPZYAM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|