C26H22Br2N4O3 — CID 43991325
N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-6,8-dibromo-2-oxochromene-3-carboxamide (PubChem CID 43991325) has the molecular formula C26H22Br2N4O3 and a molecular weight of 598.30 g/mol. Its IUPAC name is N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-6,8-dibromo-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-6,8-dibromo-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 43991325 |
| Molecular Formula | C26H22Br2N4O3 |
| Molecular Weight | 598.30 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-6,8-dibromo-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C26H22Br2N4O3/c27-18-12-17-14-20(26(34)35-24(17)21(28)15-18)25(33)29-19-7-5-6-16(13-19)22-8-9-23(31-30-22)32-10-3-1-2-4-11-32/h5-9,12-15H,1-4,10-11H2,(H,29,33) |
| InChIKey | KKUDLQPFGAGJGW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.30 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|