C18H14Br2N4O3 — CID 90545007
6,8-dibromo-2-oxo-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)chromene-3-carboxamide (PubChem CID 90545007) has the molecular formula C18H14Br2N4O3 and a molecular weight of 494.14 g/mol. Its IUPAC name is 6,8-dibromo-2-oxo-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)chromene-3-carboxamide.
| Compound Name | 6,8-dibromo-2-oxo-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 90545007 |
| Molecular Formula | C18H14Br2N4O3 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 6,8-dibromo-2-oxo-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)chromene-3-carboxamide |
| SMILES | O=C(Nc1cc(N2CCCC2)ncn1)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C18H14Br2N4O3/c19-11-5-10-6-12(18(26)27-16(10)13(20)7-11)17(25)23-14-8-15(22-9-21-14)24-3-1-2-4-24/h5-9H,1-4H2,(H,21,22,23,25) |
| InChIKey | WPEDKZDFGDHKAU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|