C23H22Cl2N4O — CID 43991326
N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4-dichlorobenzamide (PubChem CID 43991326) has the molecular formula C23H22Cl2N4O and a molecular weight of 441.36 g/mol. Its IUPAC name is N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 43991326 |
| Molecular Formula | C23H22Cl2N4O |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N4O/c24-17-8-9-19(20(25)15-17)23(30)26-18-7-5-6-16(14-18)21-10-11-22(28-27-21)29-12-3-1-2-4-13-29/h5-11,14-15H,1-4,12-13H2,(H,26,30) |
| InChIKey | SEBUQWJRWYQXHY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |