C23H22Br2N2O5 — CID 19133078
2-(diethylamino)ethyl 4-[(6,8-dibromo-2-oxochromene-3-carbonyl)amino]benzoate (PubChem CID 19133078) has the molecular formula C23H22Br2N2O5 and a molecular weight of 566.25 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(6,8-dibromo-2-oxochromene-3-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(6,8-dibromo-2-oxochromene-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19133078 |
| Molecular Formula | C23H22Br2N2O5 |
| Molecular Weight | 566.25 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(6,8-dibromo-2-oxochromene-3-carbonyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2cc3cc(Br)cc(Br)c3oc2=O)cc1 |
| InChI | InChI=1S/C23H22Br2N2O5/c1-3-27(4-2)9-10-31-22(29)14-5-7-17(8-6-14)26-21(28)18-12-15-11-16(24)13-19(25)20(15)32-23(18)30/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,26,28) |
| InChIKey | SVWYMAMIWSFCLB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|