C22H20BrNO5 — CID 19171830
3-methylbutyl 4-[(6-bromo-2-oxochromene-3-carbonyl)amino]benzoate (PubChem CID 19171830) has the molecular formula C22H20BrNO5 and a molecular weight of 458.31 g/mol. Its IUPAC name is 3-methylbutyl 4-[(6-bromo-2-oxochromene-3-carbonyl)amino]benzoate.
| Compound Name | 3-methylbutyl 4-[(6-bromo-2-oxochromene-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19171830 |
| Molecular Formula | C22H20BrNO5 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 3-methylbutyl 4-[(6-bromo-2-oxochromene-3-carbonyl)amino]benzoate |
| SMILES | CC(C)CCOC(=O)c1ccc(NC(=O)c2cc3cc(Br)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C22H20BrNO5/c1-13(2)9-10-28-21(26)14-3-6-17(7-4-14)24-20(25)18-12-15-11-16(23)5-8-19(15)29-22(18)27/h3-8,11-13H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | FHUODQUXUGJWQD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|