C26H19BrFN3O5 — CID 121062024
6-bromo-N-[2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 121062024) has the molecular formula C26H19BrFN3O5 and a molecular weight of 552.36 g/mol. Its IUPAC name is 6-bromo-N-[2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-[2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121062024 |
| Molecular Formula | C26H19BrFN3O5 |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 6-bromo-N-[2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2cc(Br)ccc2oc1=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H19BrFN3O5/c27-18-5-10-22-17(13-18)14-21(26(35)36-22)25(34)30-12-11-29-23(32)15-3-8-20(9-4-15)31-24(33)16-1-6-19(28)7-2-16/h1-10,13-14H,11-12H2,(H,29,32)(H,30,34)(H,31,33) |
| InChIKey | QHUZQVVWSVRGCA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|