C19H16BrNO3 — CID 3816186
6-bromo-2-oxo-N-(3-phenylpropyl)chromene-3-carboxamide (PubChem CID 3816186) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 6-bromo-2-oxo-N-(3-phenylpropyl)chromene-3-carboxamide.
| Compound Name | 6-bromo-2-oxo-N-(3-phenylpropyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 3816186 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 6-bromo-2-oxo-N-(3-phenylpropyl)chromene-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C19H16BrNO3/c20-15-8-9-17-14(11-15)12-16(19(23)24-17)18(22)21-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11-12H,4,7,10H2,(H,21,22) |
| InChIKey | UAZRZNPSXYAYLD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|